About 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol
3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol (PubChem CID 23368503) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol |
| PubChem CID | 23368503 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol |
| SMILES | COCC(N)COc1noc2ccc(O)cc12 |
| InChI | InChI=1S/C11H14N2O4/c1-15-5-7(12)6-16-11-9-4-8(14)2-3-10(9)17-13-11/h2-4,7,14H,5-6,12H2,1H3 |
| InChIKey | IJPVBWQRNVJZTI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol?
The IUPAC name of 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol (CID 23368503) is 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol.
What is the SMILES notation for 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol?
The canonical SMILES for 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol is COCC(N)COc1noc2ccc(O)cc12.
What is the InChIKey of 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol?
The InChIKey is IJPVBWQRNVJZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4/c1-15-5-7(12)6-16-11-9-4-8(14)2-3-10(9)17-13-11/h2-4,7,14H,5-6,12H2,1H3.
What are the key properties of 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol?
3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol has a molecular weight of 238.24 g/mol, XLogP of 0.89, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol is sourced from PubChem (CID 23368503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).