C11H14N2O4 — CID 23368503
3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol (PubChem CID 23368503) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol.
| Compound Name | 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol |
|---|---|
| PubChem CID | 23368503 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-(2-amino-3-methoxypropoxy)-1,2-benzoxazol-5-ol |
| SMILES | COCC(N)COc1noc2ccc(O)cc12 |
| InChI | InChI=1S/C11H14N2O4/c1-15-5-7(12)6-16-11-9-4-8(14)2-3-10(9)17-13-11/h2-4,7,14H,5-6,12H2,1H3 |
| InChIKey | IJPVBWQRNVJZTI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |