About 3-(bromomethyl)-1,2-benzoxazol-5-ol
3-(bromomethyl)-1,2-benzoxazol-5-ol (PubChem CID 119090322) has the molecular formula C8H6BrNO2
and a molecular weight of 228.04 g/mol. Its IUPAC name is 3-(bromomethyl)-1,2-benzoxazol-5-ol.
Molecular Properties
| Compound Name | 3-(bromomethyl)-1,2-benzoxazol-5-ol |
| PubChem CID | 119090322 |
| Molecular Formula | C8H6BrNO2 |
| Molecular Weight | 228.04 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | 3-(bromomethyl)-1,2-benzoxazol-5-ol |
| SMILES | Oc1ccc2onc(CBr)c2c1 |
| InChI | InChI=1S/C8H6BrNO2/c9-4-7-6-3-5(11)1-2-8(6)12-10-7/h1-3,11H,4H2 |
| InChIKey | IPGIVILDQAVVLC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.04 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-1,2-benzoxazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-1,2-benzoxazol-5-ol?
The IUPAC name of 3-(bromomethyl)-1,2-benzoxazol-5-ol (CID 119090322) is 3-(bromomethyl)-1,2-benzoxazol-5-ol.
What is the SMILES notation for 3-(bromomethyl)-1,2-benzoxazol-5-ol?
The canonical SMILES for 3-(bromomethyl)-1,2-benzoxazol-5-ol is Oc1ccc2onc(CBr)c2c1.
What is the InChIKey of 3-(bromomethyl)-1,2-benzoxazol-5-ol?
The InChIKey is IPGIVILDQAVVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNO2/c9-4-7-6-3-5(11)1-2-8(6)12-10-7/h1-3,11H,4H2.
What are the key properties of 3-(bromomethyl)-1,2-benzoxazol-5-ol?
3-(bromomethyl)-1,2-benzoxazol-5-ol has a molecular weight of 228.04 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-1,2-benzoxazol-5-ol is sourced from PubChem (CID 119090322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).