C10H11NO — CID 70293590
5-ethyl-3-methyl-1,2-benzoxazole (PubChem CID 70293590) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 5-ethyl-3-methyl-1,2-benzoxazole.
| Compound Name | 5-ethyl-3-methyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 70293590 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 5-ethyl-3-methyl-1,2-benzoxazole |
| SMILES | CCc1ccc2onc(C)c2c1 |
| InChI | InChI=1S/C10H11NO/c1-3-8-4-5-10-9(6-8)7(2)11-12-10/h4-6H,3H2,1-2H3 |
| InChIKey | VKADRLWQUCKFBX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |