C13H22N2O — CID 143545769
ethane;6-ethyl-1,2-benzoxazol-3-amine (PubChem CID 143545769) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;6-ethyl-1,2-benzoxazol-3-amine.
| Compound Name | ethane;6-ethyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 143545769 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | ethane;6-ethyl-1,2-benzoxazol-3-amine |
| SMILES | CC.CC.CCc1ccc2c(N)noc2c1 |
| InChI | InChI=1S/C9H10N2O.2C2H6/c1-2-6-3-4-7-8(5-6)12-11-9(7)10;2*1-2/h3-5H,2H2,1H3,(H2,10,11);2*1-2H3 |
| InChIKey | YQJWHUKAQWWTOE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |