C11H16N2O — CID 143324107
ethane;5-ethyl-1,2-benzoxazol-3-amine (PubChem CID 143324107) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;5-ethyl-1,2-benzoxazol-3-amine.
| Compound Name | ethane;5-ethyl-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 143324107 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;5-ethyl-1,2-benzoxazol-3-amine |
| SMILES | CC.CCc1ccc2onc(N)c2c1 |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-2-6-3-4-8-7(5-6)9(10)11-12-8;1-2/h3-5H,2H2,1H3,(H2,10,11);1-2H3 |
| InChIKey | KRAPMHVDUVNXPK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |