About CID 163989385
CID 163989385 (PubChem CID 163989385) has the molecular formula C7H6BN2O2
and a molecular weight of 160.95 g/mol.
Molecular Properties
| Compound Name | CID 163989385 |
| PubChem CID | 163989385 |
| Molecular Formula | C7H6BN2O2 |
| Molecular Weight | 160.95 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | — |
| SMILES | Nc1noc2ccc([B]O)cc12 |
| InChI | InChI=1S/C7H6BN2O2/c9-7-5-3-4(8-11)1-2-6(5)12-10-7/h1-3,11H,(H2,9,10) |
| InChIKey | VHDDWVUZTLYPGE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.95 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163989385 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163989385?
The IUPAC name of CID 163989385 (CID 163989385) is not available.
What is the SMILES notation for CID 163989385?
The canonical SMILES for CID 163989385 is Nc1noc2ccc([B]O)cc12.
What is the InChIKey of CID 163989385?
The InChIKey is VHDDWVUZTLYPGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BN2O2/c9-7-5-3-4(8-11)1-2-6(5)12-10-7/h1-3,11H,(H2,9,10).
What are the key properties of CID 163989385?
CID 163989385 has a molecular weight of 160.95 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163989385 is sourced from PubChem (CID 163989385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).