C12H15N3O — CID 170495935
5-[4-(methylamino)but-1-enyl]-1,2-benzoxazol-3-amine (PubChem CID 170495935) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-[4-(methylamino)but-1-enyl]-1,2-benzoxazol-3-amine.
| Compound Name | 5-[4-(methylamino)but-1-enyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 170495935 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 5-[4-(methylamino)but-1-enyl]-1,2-benzoxazol-3-amine |
| SMILES | CNCCC=Cc1ccc2onc(N)c2c1 |
| InChI | InChI=1S/C12H15N3O/c1-14-7-3-2-4-9-5-6-11-10(8-9)12(13)15-16-11/h2,4-6,8,14H,3,7H2,1H3,(H2,13,15) |
| InChIKey | MHLTWRVGLMBJMS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|