C14H23NSi — CID 170495970
N-methyl-4-(3-trimethylsilylphenyl)but-3-en-1-amine (PubChem CID 170495970) has the molecular formula C14H23NSi and a molecular weight of 233.43 g/mol. Its IUPAC name is N-methyl-4-(3-trimethylsilylphenyl)but-3-en-1-amine.
| Compound Name | N-methyl-4-(3-trimethylsilylphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 170495970 |
| Molecular Formula | C14H23NSi |
| Molecular Weight | 233.43 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | N-methyl-4-(3-trimethylsilylphenyl)but-3-en-1-amine |
| SMILES | CNCCC=Cc1cccc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C14H23NSi/c1-15-11-6-5-8-13-9-7-10-14(12-13)16(2,3)4/h5,7-10,12,15H,6,11H2,1-4H3 |
| InChIKey | DPSDFICQBKJWOK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|