C14H21N — CID 116546325
(E)-N-methyl-4-(3-propylphenyl)but-3-en-1-amine (PubChem CID 116546325) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (E)-N-methyl-4-(3-propylphenyl)but-3-en-1-amine.
| Compound Name | (E)-N-methyl-4-(3-propylphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 116546325 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (E)-N-methyl-4-(3-propylphenyl)but-3-en-1-amine |
| SMILES | CCCc1cccc(/C=C/CCNC)c1 |
| InChI | InChI=1S/C14H21N/c1-3-7-13-9-6-10-14(12-13)8-4-5-11-15-2/h4,6,8-10,12,15H,3,5,7,11H2,1-2H3/b8-4+ |
| InChIKey | MJTQGCPTONZVFH-XBXARRHUSA-N |
| XLogP | 3.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|