C14H21NOSi — CID 169465674
N-[3-(3-trimethylsilylphenyl)prop-2-enyl]acetamide (PubChem CID 169465674) has the molecular formula C14H21NOSi and a molecular weight of 247.41 g/mol. Its IUPAC name is N-[3-(3-trimethylsilylphenyl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(3-trimethylsilylphenyl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169465674 |
| Molecular Formula | C14H21NOSi |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[3-(3-trimethylsilylphenyl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1cccc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C14H21NOSi/c1-12(16)15-10-6-8-13-7-5-9-14(11-13)17(2,3)4/h5-9,11H,10H2,1-4H3,(H,15,16) |
| InChIKey | FLKMRMUQBCELHE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|