C13H17NO2 — CID 169465370
N-[3-[3-(2-hydroxyethyl)phenyl]prop-2-enyl]acetamide (PubChem CID 169465370) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is N-[3-[3-(2-hydroxyethyl)phenyl]prop-2-enyl]acetamide.
| Compound Name | N-[3-[3-(2-hydroxyethyl)phenyl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 169465370 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-[3-[3-(2-hydroxyethyl)phenyl]prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC=Cc1cccc(CCO)c1 |
| InChI | InChI=1S/C13H17NO2/c1-11(16)14-8-3-6-12-4-2-5-13(10-12)7-9-15/h2-6,10,15H,7-9H2,1H3,(H,14,16) |
| InChIKey | RFWINQFVVNXSSO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |