C13H16O3 — CID 170477090
methyl 2-[3-(4-hydroxybut-1-enyl)phenyl]acetate (PubChem CID 170477090) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 2-[3-(4-hydroxybut-1-enyl)phenyl]acetate.
| Compound Name | methyl 2-[3-(4-hydroxybut-1-enyl)phenyl]acetate |
|---|---|
| PubChem CID | 170477090 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | methyl 2-[3-(4-hydroxybut-1-enyl)phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(C=CCCO)c1 |
| InChI | InChI=1S/C13H16O3/c1-16-13(15)10-12-7-4-6-11(9-12)5-2-3-8-14/h2,4-7,9,14H,3,8,10H2,1H3 |
| InChIKey | XEXOUGCCLBHUPS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |