C25H25NO4 — CID 90909020
methyl 2-[3-[4-[2-(4-methoxybenzoyl)pyrrol-1-yl]but-1-enyl]phenyl]acetate (PubChem CID 90909020) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl 2-[3-[4-[2-(4-methoxybenzoyl)pyrrol-1-yl]but-1-enyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[4-[2-(4-methoxybenzoyl)pyrrol-1-yl]but-1-enyl]phenyl]acetate |
|---|---|
| PubChem CID | 90909020 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | methyl 2-[3-[4-[2-(4-methoxybenzoyl)pyrrol-1-yl]but-1-enyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(C=CCCn2cccc2C(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C25H25NO4/c1-29-22-13-11-21(12-14-22)25(28)23-10-6-16-26(23)15-4-3-7-19-8-5-9-20(17-19)18-24(27)30-2/h3,5-14,16-17H,4,15,18H2,1-2H3 |
| InChIKey | OZZUJXXLBQMMRJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |