C28H31NO4 — CID 58863622
tert-butyl 2-[3-[(E)-4-[2-(4-methylbenzoyl)pyrrol-1-yl]but-1-enyl]phenoxy]acetate (PubChem CID 58863622) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl 2-[3-[(E)-4-[2-(4-methylbenzoyl)pyrrol-1-yl]but-1-enyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-[(E)-4-[2-(4-methylbenzoyl)pyrrol-1-yl]but-1-enyl]phenoxy]acetate |
|---|---|
| PubChem CID | 58863622 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | tert-butyl 2-[3-[(E)-4-[2-(4-methylbenzoyl)pyrrol-1-yl]but-1-enyl]phenoxy]acetate |
| SMILES | Cc1ccc(C(=O)c2cccn2CC/C=C/c2cccc(OCC(=O)OC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-21-13-15-23(16-14-21)27(31)25-12-8-18-29(25)17-6-5-9-22-10-7-11-24(19-22)32-20-26(30)33-28(2,3)4/h5,7-16,18-19H,6,17,20H2,1-4H3/b9-5+ |
| InChIKey | MBMUUWQYPZILFA-WEVVVXLNSA-N |
| XLogP | 5.85 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |