C26H23NO2 — CID 122219338
(4-methoxyphenyl)-[1-[(Z)-4-phenylbut-3-enyl]indol-3-yl]methanone (PubChem CID 122219338) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is (4-methoxyphenyl)-[1-[(Z)-4-phenylbut-3-enyl]indol-3-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[1-[(Z)-4-phenylbut-3-enyl]indol-3-yl]methanone |
|---|---|
| PubChem CID | 122219338 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (4-methoxyphenyl)-[1-[(Z)-4-phenylbut-3-enyl]indol-3-yl]methanone |
| SMILES | COc1ccc(C(=O)c2cn(CC/C=C\c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C26H23NO2/c1-29-22-16-14-21(15-17-22)26(28)24-19-27(25-13-6-5-12-23(24)25)18-8-7-11-20-9-3-2-4-10-20/h2-7,9-17,19H,8,18H2,1H3/b11-7- |
| InChIKey | LDYWVZOHCRKRGM-XFFZJAGNSA-N |
| XLogP | 5.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |