C34H37NO4 — CID 67873715
4-[3-[4-[5-[4-(2-methylpropyl)phenyl]pent-1-enoxy]benzoyl]indol-1-yl]butanoic acid (PubChem CID 67873715) has the molecular formula C34H37NO4 and a molecular weight of 523.67 g/mol. Its IUPAC name is 4-[3-[4-[5-[4-(2-methylpropyl)phenyl]pent-1-enoxy]benzoyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-[4-[5-[4-(2-methylpropyl)phenyl]pent-1-enoxy]benzoyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 67873715 |
| Molecular Formula | C34H37NO4 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 4-[3-[4-[5-[4-(2-methylpropyl)phenyl]pent-1-enoxy]benzoyl]indol-1-yl]butanoic acid |
| SMILES | CC(C)Cc1ccc(CCCC=COc2ccc(C(=O)c3cn(CCCC(=O)O)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C34H37NO4/c1-25(2)23-27-15-13-26(14-16-27)9-4-3-7-22-39-29-19-17-28(18-20-29)34(38)31-24-35(21-8-12-33(36)37)32-11-6-5-10-30(31)32/h5-7,10-11,13-20,22,24-25H,3-4,8-9,12,21,23H2,1-2H3,(H,36,37) |
| InChIKey | OZDBYANKMSUDIF-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|