C34H37NO4 — CID 56988647
4-[3-[4-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pentoxy]benzoyl]indol-1-yl]butanoic acid (PubChem CID 56988647) has the molecular formula C34H37NO4 and a molecular weight of 523.67 g/mol. Its IUPAC name is 4-[3-[4-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pentoxy]benzoyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-[4-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pentoxy]benzoyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 56988647 |
| Molecular Formula | C34H37NO4 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | 4-[3-[4-[5-(5,6,7,8-tetrahydronaphthalen-2-yl)pentoxy]benzoyl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(C(=O)c2ccc(OCCCCCc3ccc4c(c3)CCCC4)cc2)c2ccccc21 |
| InChI | InChI=1S/C34H37NO4/c36-33(37)14-8-21-35-24-31(30-12-5-6-13-32(30)35)34(38)27-17-19-29(20-18-27)39-22-7-1-2-9-25-15-16-26-10-3-4-11-28(26)23-25/h5-6,12-13,15-20,23-24H,1-4,7-11,14,21-22H2,(H,36,37) |
| InChIKey | XUAYIRNBMOVIHV-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|