C34H37NO5 — CID 69379644
4-[1-(3-carboxypropyl)indol-3-yl]-3-[4-[(4-pentylphenyl)methoxy]phenyl]but-3-enoic acid (PubChem CID 69379644) has the molecular formula C34H37NO5 and a molecular weight of 539.67 g/mol. Its IUPAC name is 4-[1-(3-carboxypropyl)indol-3-yl]-3-[4-[(4-pentylphenyl)methoxy]phenyl]but-3-enoic acid.
| Compound Name | 4-[1-(3-carboxypropyl)indol-3-yl]-3-[4-[(4-pentylphenyl)methoxy]phenyl]but-3-enoic acid |
|---|---|
| PubChem CID | 69379644 |
| Molecular Formula | C34H37NO5 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | 4-[1-(3-carboxypropyl)indol-3-yl]-3-[4-[(4-pentylphenyl)methoxy]phenyl]but-3-enoic acid |
| SMILES | CCCCCc1ccc(COc2ccc(C(=Cc3cn(CCCC(=O)O)c4ccccc34)CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H37NO5/c1-2-3-4-8-25-12-14-26(15-13-25)24-40-30-18-16-27(17-19-30)28(22-34(38)39)21-29-23-35(20-7-11-33(36)37)32-10-6-5-9-31(29)32/h5-6,9-10,12-19,21,23H,2-4,7-8,11,20,22,24H2,1H3,(H,36,37)(H,38,39) |
| InChIKey | RSWDGIPYFOELAI-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|