C33H33NO5 — CID 173480006
4-[3-[(E)-2-carboxyethenyl]-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 173480006) has the molecular formula C33H33NO5 and a molecular weight of 523.63 g/mol. Its IUPAC name is 4-[3-[(E)-2-carboxyethenyl]-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-[(E)-2-carboxyethenyl]-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 173480006 |
| Molecular Formula | C33H33NO5 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.24 |
| IUPAC Name | 4-[3-[(E)-2-carboxyethenyl]-4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)/C=C/c1cn(CCCC(=O)O)c2cccc(C=Cc3ccc(OCCCCc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C33H33NO5/c35-31(36)13-7-22-34-24-28(18-21-32(37)38)33-27(11-6-12-30(33)34)17-14-26-15-19-29(20-16-26)39-23-5-4-10-25-8-2-1-3-9-25/h1-3,6,8-9,11-12,14-21,24H,4-5,7,10,13,22-23H2,(H,35,36)(H,37,38)/b17-14?,21-18+ |
| InChIKey | FBNKYHFQLRZLNG-DDAAIGKBSA-N |
| XLogP | 7.18 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|