C27H29NO5 — CID 68696283
4-[3-(carboxymethyl)-4-[(E)-2-(4-pent-4-enoxyphenyl)ethenyl]indol-1-yl]butanoic acid (PubChem CID 68696283) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[(E)-2-(4-pent-4-enoxyphenyl)ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[(E)-2-(4-pent-4-enoxyphenyl)ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68696283 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[(E)-2-(4-pent-4-enoxyphenyl)ethenyl]indol-1-yl]butanoic acid |
| SMILES | C=CCCCOc1ccc(/C=C/c2cccc3c2c(CC(=O)O)cn3CCCC(=O)O)cc1 |
| InChI | InChI=1S/C27H29NO5/c1-2-3-4-17-33-23-14-11-20(12-15-23)10-13-21-7-5-8-24-27(21)22(18-26(31)32)19-28(24)16-6-9-25(29)30/h2,5,7-8,10-15,19H,1,3-4,6,9,16-18H2,(H,29,30)(H,31,32)/b13-10+ |
| InChIKey | MSDDOYHWZMVNCP-JLHYYAGUSA-N |
| XLogP | 5.65 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|