C32H30F3NO6 — CID 68690095
4-[3-(carboxymethyl)-4-[2-[4-[4-(2,3,4-trifluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 68690095) has the molecular formula C32H30F3NO6 and a molecular weight of 581.59 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[2-[4-[4-(2,3,4-trifluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(2,3,4-trifluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68690095 |
| Molecular Formula | C32H30F3NO6 |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(2,3,4-trifluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(CC(=O)O)c2c(C=Cc3ccc(OCCCCOc4ccc(F)c(F)c4F)cc3)cccc21 |
| InChI | InChI=1S/C32H30F3NO6/c33-25-14-15-27(32(35)31(25)34)42-18-2-1-17-41-24-12-9-21(10-13-24)8-11-22-5-3-6-26-30(22)23(19-29(39)40)20-36(26)16-4-7-28(37)38/h3,5-6,8-15,20H,1-2,4,7,16-19H2,(H,37,38)(H,39,40) |
| InChIKey | BAZDRWPVCVQNPM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|