C34H36FNO6 — CID 69378550
4-[3-(carboxymethyl)-4-[2-[4-[4-(4-fluoro-2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 69378550) has the molecular formula C34H36FNO6 and a molecular weight of 573.66 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[2-[4-[4-(4-fluoro-2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(4-fluoro-2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 69378550 |
| Molecular Formula | C34H36FNO6 |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(4-fluoro-2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | Cc1cc(F)cc(C)c1OCCCCOc1ccc(C=Cc2cccc3c2c(CC(=O)O)cn3CCCC(=O)O)cc1 |
| InChI | InChI=1S/C34H36FNO6/c1-23-19-28(35)20-24(2)34(23)42-18-4-3-17-41-29-14-11-25(12-15-29)10-13-26-7-5-8-30-33(26)27(21-32(39)40)22-36(30)16-6-9-31(37)38/h5,7-8,10-15,19-20,22H,3-4,6,9,16-18,21H2,1-2H3,(H,37,38)(H,39,40) |
| InChIKey | JICOEPGKRNSEJX-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|