C32H33NO6 — CID 68692864
2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid (PubChem CID 68692864) has the molecular formula C32H33NO6 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid.
| Compound Name | 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 68692864 |
| Molecular Formula | C32H33NO6 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | 2-[1-(carboxymethyl)-4-[(E)-2-[4-[4-(2,6-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-3-yl]acetic acid |
| SMILES | Cc1cccc(C)c1OCCCCOc1ccc(/C=C/c2cccc3c2c(CC(=O)O)cn3CC(=O)O)cc1 |
| InChI | InChI=1S/C32H33NO6/c1-22-7-5-8-23(2)32(22)39-18-4-3-17-38-27-15-12-24(13-16-27)11-14-25-9-6-10-28-31(25)26(19-29(34)35)20-33(28)21-30(36)37/h5-16,20H,3-4,17-19,21H2,1-2H3,(H,34,35)(H,36,37)/b14-11+ |
| InChIKey | MXALAXDZFJTDFG-SDNWHVSQSA-N |
| XLogP | 6.38 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|