C31H31NO6 — CID 68691452
2-[1-(carboxymethyl)-4-[2-[4-(4-phenylmethoxybutoxy)phenyl]ethenyl]indol-3-yl]acetic acid (PubChem CID 68691452) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-[1-(carboxymethyl)-4-[2-[4-(4-phenylmethoxybutoxy)phenyl]ethenyl]indol-3-yl]acetic acid.
| Compound Name | 2-[1-(carboxymethyl)-4-[2-[4-(4-phenylmethoxybutoxy)phenyl]ethenyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 68691452 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 2-[1-(carboxymethyl)-4-[2-[4-(4-phenylmethoxybutoxy)phenyl]ethenyl]indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(CC(=O)O)c2cccc(C=Cc3ccc(OCCCCOCc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C31H31NO6/c33-29(34)19-26-20-32(21-30(35)36)28-10-6-9-25(31(26)28)14-11-23-12-15-27(16-13-23)38-18-5-4-17-37-22-24-7-2-1-3-8-24/h1-3,6-16,20H,4-5,17-19,21-22H2,(H,33,34)(H,35,36) |
| InChIKey | HATHWOAFZBKJIY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|