C33H34FNO6 — CID 68695774
4-[3-(carboxymethyl)-4-[2-[4-[4-(3-fluoro-4-methylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 68695774) has the molecular formula C33H34FNO6 and a molecular weight of 559.63 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[2-[4-[4-(3-fluoro-4-methylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(3-fluoro-4-methylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68695774 |
| Molecular Formula | C33H34FNO6 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(3-fluoro-4-methylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | Cc1ccc(OCCCCOc2ccc(C=Cc3cccc4c3c(CC(=O)O)cn4CCCC(=O)O)cc2)cc1F |
| InChI | InChI=1S/C33H34FNO6/c1-23-9-14-28(21-29(23)34)41-19-3-2-18-40-27-15-11-24(12-16-27)10-13-25-6-4-7-30-33(25)26(20-32(38)39)22-35(30)17-5-8-31(36)37/h4,6-7,9-16,21-22H,2-3,5,8,17-20H2,1H3,(H,36,37)(H,38,39) |
| InChIKey | CDYNWTVBCNKRJC-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|