C34H37NO6 — CID 68694196
4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(3,5-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 68694196) has the molecular formula C34H37NO6 and a molecular weight of 555.67 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(3,5-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(3,5-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68694196 |
| Molecular Formula | C34H37NO6 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(3,5-dimethylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | Cc1cc(C)cc(OCCCCOc2ccc(/C=C/c3cccc4c3c(CC(=O)O)cn4CCCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C34H37NO6/c1-24-19-25(2)21-30(20-24)41-18-4-3-17-40-29-14-11-26(12-15-29)10-13-27-7-5-8-31-34(27)28(22-33(38)39)23-35(31)16-6-9-32(36)37/h5,7-8,10-15,19-21,23H,3-4,6,9,16-18,22H2,1-2H3,(H,36,37)(H,38,39)/b13-10+ |
| InChIKey | TUKJWBSCERRCHE-JLHYYAGUSA-N |
| XLogP | 7.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|