C32H32FNO5S — CID 68695119
4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(4-fluorophenyl)sulfanylbutoxy]phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 68695119) has the molecular formula C32H32FNO5S and a molecular weight of 561.68 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(4-fluorophenyl)sulfanylbutoxy]phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(4-fluorophenyl)sulfanylbutoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68695119 |
| Molecular Formula | C32H32FNO5S |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(4-fluorophenyl)sulfanylbutoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(CC(=O)O)c2c(/C=C/c3ccc(OCCCCSc4ccc(F)cc4)cc3)cccc21 |
| InChI | InChI=1S/C32H32FNO5S/c33-26-12-16-28(17-13-26)40-20-2-1-19-39-27-14-9-23(10-15-27)8-11-24-5-3-6-29-32(24)25(21-31(37)38)22-34(29)18-4-7-30(35)36/h3,5-6,8-17,22H,1-2,4,7,18-21H2,(H,35,36)(H,37,38)/b11-8+ |
| InChIKey | CTUPYDMICGPHPK-DHZHZOJOSA-N |
| XLogP | 7.39 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|