C31H28N2O5S2 — CID 68690510
4-[4-[2-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)ethoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid (PubChem CID 68690510) has the molecular formula C31H28N2O5S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 4-[4-[2-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)ethoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid.
| Compound Name | 4-[4-[2-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)ethoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68690510 |
| Molecular Formula | C31H28N2O5S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 4-[4-[2-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)ethoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(CC(=O)O)c2c(C=Cc3ccc(OCCSc4nc5ccccc5s4)cc3)cccc21 |
| InChI | InChI=1S/C31H28N2O5S2/c34-28(35)9-4-16-33-20-23(19-29(36)37)30-22(5-3-7-26(30)33)13-10-21-11-14-24(15-12-21)38-17-18-39-31-32-25-6-1-2-8-27(25)40-31/h1-3,5-8,10-15,20H,4,9,16-19H2,(H,34,35)(H,36,37) |
| InChIKey | VNWBXNFZOGYTQB-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|