C32H31NO5 — CID 68693797
4-[3-(carboxymethyl)-4-[(E)-2-[4-(2,3-dihydro-1H-inden-2-ylmethoxy)phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 68693797) has the molecular formula C32H31NO5 and a molecular weight of 509.60 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[(E)-2-[4-(2,3-dihydro-1H-inden-2-ylmethoxy)phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-(2,3-dihydro-1H-inden-2-ylmethoxy)phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68693797 |
| Molecular Formula | C32H31NO5 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-(2,3-dihydro-1H-inden-2-ylmethoxy)phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(CC(=O)O)c2c(/C=C/c3ccc(OCC4Cc5ccccc5C4)cc3)cccc21 |
| InChI | InChI=1S/C32H31NO5/c34-30(35)9-4-16-33-20-27(19-31(36)37)32-24(7-3-8-29(32)33)13-10-22-11-14-28(15-12-22)38-21-23-17-25-5-1-2-6-26(25)18-23/h1-3,5-8,10-15,20,23H,4,9,16-19,21H2,(H,34,35)(H,36,37)/b13-10+ |
| InChIKey | BYCVTWPTWFUTLP-JLHYYAGUSA-N |
| XLogP | 6.10 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|