C31H37NO5 — CID 11853429
4-[3-(carboxymethyl)-4-[(E)-2-[4-(3-cyclohexylpropoxy)phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 11853429) has the molecular formula C31H37NO5 and a molecular weight of 503.64 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[(E)-2-[4-(3-cyclohexylpropoxy)phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-(3-cyclohexylpropoxy)phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 11853429 |
| Molecular Formula | C31H37NO5 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-(3-cyclohexylpropoxy)phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(CC(=O)O)c2c(/C=C/c3ccc(OCCCC4CCCCC4)cc3)cccc21 |
| InChI | InChI=1S/C31H37NO5/c33-29(34)12-5-19-32-22-26(21-30(35)36)31-25(10-4-11-28(31)32)16-13-24-14-17-27(18-15-24)37-20-6-9-23-7-2-1-3-8-23/h4,10-11,13-18,22-23H,1-3,5-9,12,19-21H2,(H,33,34)(H,35,36)/b16-13+ |
| InChIKey | YYKQTGSTGPMAGS-DTQAZKPQSA-N |
| XLogP | 7.04 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|