C36H39NO6 — CID 68693014
4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(2-methyl-6-prop-2-enylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 68693014) has the molecular formula C36H39NO6 and a molecular weight of 581.71 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(2-methyl-6-prop-2-enylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(2-methyl-6-prop-2-enylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68693014 |
| Molecular Formula | C36H39NO6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[(E)-2-[4-[4-(2-methyl-6-prop-2-enylphenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | C=CCc1cccc(C)c1OCCCCOc1ccc(/C=C/c2cccc3c2c(CC(=O)O)cn3CCCC(=O)O)cc1 |
| InChI | InChI=1S/C36H39NO6/c1-3-9-29-12-6-10-26(2)36(29)43-23-5-4-22-42-31-19-16-27(17-20-31)15-18-28-11-7-13-32-35(28)30(24-34(40)41)25-37(32)21-8-14-33(38)39/h3,6-7,10-13,15-20,25H,1,4-5,8-9,14,21-24H2,2H3,(H,38,39)(H,40,41)/b18-15+ |
| InChIKey | GADGDACSZPLMSV-OBGWFSINSA-N |
| XLogP | 7.58 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|