C32H31ClFNO6 — CID 68688935
4-[3-(carboxymethyl)-4-[2-[4-[4-(2-chloro-6-fluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid (PubChem CID 68688935) has the molecular formula C32H31ClFNO6 and a molecular weight of 580.05 g/mol. Its IUPAC name is 4-[3-(carboxymethyl)-4-[2-[4-[4-(2-chloro-6-fluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(2-chloro-6-fluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 68688935 |
| Molecular Formula | C32H31ClFNO6 |
| Molecular Weight | 580.05 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 4-[3-(carboxymethyl)-4-[2-[4-[4-(2-chloro-6-fluorophenoxy)butoxy]phenyl]ethenyl]indol-1-yl]butanoic acid |
| SMILES | O=C(O)CCCn1cc(CC(=O)O)c2c(C=Cc3ccc(OCCCCOc4c(F)cccc4Cl)cc3)cccc21 |
| InChI | InChI=1S/C32H31ClFNO6/c33-26-7-4-8-27(34)32(26)41-19-2-1-18-40-25-15-12-22(13-16-25)11-14-23-6-3-9-28-31(23)24(20-30(38)39)21-35(28)17-5-10-29(36)37/h3-4,6-9,11-16,21H,1-2,5,10,17-20H2,(H,36,37)(H,38,39) |
| InChIKey | KHGHUFUDESSEGI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.05 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|