C34H34FNO7 — CID 69379372
4-[4-[2-[4-[4-(2-acetyl-5-fluorophenoxy)butoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid (PubChem CID 69379372) has the molecular formula C34H34FNO7 and a molecular weight of 587.64 g/mol. Its IUPAC name is 4-[4-[2-[4-[4-(2-acetyl-5-fluorophenoxy)butoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid.
| Compound Name | 4-[4-[2-[4-[4-(2-acetyl-5-fluorophenoxy)butoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 69379372 |
| Molecular Formula | C34H34FNO7 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 4-[4-[2-[4-[4-(2-acetyl-5-fluorophenoxy)butoxy]phenyl]ethenyl]-3-(carboxymethyl)indol-1-yl]butanoic acid |
| SMILES | CC(=O)c1ccc(F)cc1OCCCCOc1ccc(C=Cc2cccc3c2c(CC(=O)O)cn3CCCC(=O)O)cc1 |
| InChI | InChI=1S/C34H34FNO7/c1-23(37)29-16-13-27(35)21-31(29)43-19-3-2-18-42-28-14-10-24(11-15-28)9-12-25-6-4-7-30-34(25)26(20-33(40)41)22-36(30)17-5-8-32(38)39/h4,6-7,9-16,21-22H,2-3,5,8,17-20H2,1H3,(H,38,39)(H,40,41) |
| InChIKey | GKWLQTFXHZWVAN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|