C32H33N5O3 — CID 68691923
2-[4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-1-[3-(2H-tetrazol-5-yl)propyl]indol-3-yl]acetic acid (PubChem CID 68691923) has the molecular formula C32H33N5O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is 2-[4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-1-[3-(2H-tetrazol-5-yl)propyl]indol-3-yl]acetic acid.
| Compound Name | 2-[4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-1-[3-(2H-tetrazol-5-yl)propyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 68691923 |
| Molecular Formula | C32H33N5O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | 2-[4-[2-[4-(4-phenylbutoxy)phenyl]ethenyl]-1-[3-(2H-tetrazol-5-yl)propyl]indol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cn(CCCc2nn[nH]n2)c2cccc(C=Cc3ccc(OCCCCc4ccccc4)cc3)c12 |
| InChI | InChI=1S/C32H33N5O3/c38-31(39)22-27-23-37(20-7-13-30-33-35-36-34-30)29-12-6-11-26(32(27)29)17-14-25-15-18-28(19-16-25)40-21-5-4-10-24-8-2-1-3-9-24/h1-3,6,8-9,11-12,14-19,23H,4-5,7,10,13,20-22H2,(H,38,39)(H,33,34,35,36) |
| InChIKey | OOAOOLJXYFEJCL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|