C31H32N6O3 — CID 143283184
N-[1-(4-oxobutyl)-3-(2H-tetrazol-5-ylmethyl)indol-4-yl]-4-(4-phenylbutoxy)benzamide (PubChem CID 143283184) has the molecular formula C31H32N6O3 and a molecular weight of 536.64 g/mol. Its IUPAC name is N-[1-(4-oxobutyl)-3-(2H-tetrazol-5-ylmethyl)indol-4-yl]-4-(4-phenylbutoxy)benzamide.
| Compound Name | N-[1-(4-oxobutyl)-3-(2H-tetrazol-5-ylmethyl)indol-4-yl]-4-(4-phenylbutoxy)benzamide |
|---|---|
| PubChem CID | 143283184 |
| Molecular Formula | C31H32N6O3 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | N-[1-(4-oxobutyl)-3-(2H-tetrazol-5-ylmethyl)indol-4-yl]-4-(4-phenylbutoxy)benzamide |
| SMILES | O=CCCCn1cc(Cc2nn[nH]n2)c2c(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)cccc21 |
| InChI | InChI=1S/C31H32N6O3/c38-19-6-5-18-37-22-25(21-29-33-35-36-34-29)30-27(12-8-13-28(30)37)32-31(39)24-14-16-26(17-15-24)40-20-7-4-11-23-9-2-1-3-10-23/h1-3,8-10,12-17,19,22H,4-7,11,18,20-21H2,(H,32,39)(H,33,34,35,36) |
| InChIKey | BQUAKAVIIMUFNP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|