C28H25N5O4 — CID 15087141
N-[6-methyl-4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-4-(4-phenylbutoxy)benzamide (PubChem CID 15087141) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is N-[6-methyl-4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-4-(4-phenylbutoxy)benzamide.
| Compound Name | N-[6-methyl-4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-4-(4-phenylbutoxy)benzamide |
|---|---|
| PubChem CID | 15087141 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[6-methyl-4-oxo-2-(2H-tetrazol-5-yl)chromen-8-yl]-4-(4-phenylbutoxy)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(OCCCCc3ccccc3)cc2)c2oc(-c3nn[nH]n3)cc(=O)c2c1 |
| InChI | InChI=1S/C28H25N5O4/c1-18-15-22-24(34)17-25(27-30-32-33-31-27)37-26(22)23(16-18)29-28(35)20-10-12-21(13-11-20)36-14-6-5-9-19-7-3-2-4-8-19/h2-4,7-8,10-13,15-17H,5-6,9,14H2,1H3,(H,29,35)(H,30,31,32,33) |
| InChIKey | NHNNCNBKKPJZKE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|