C31H31NO6 — CID 139926708
tert-butyl 4-oxo-8-[[4-(4-phenylbutoxy)benzoyl]amino]chromene-2-carboxylate (PubChem CID 139926708) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is tert-butyl 4-oxo-8-[[4-(4-phenylbutoxy)benzoyl]amino]chromene-2-carboxylate.
| Compound Name | tert-butyl 4-oxo-8-[[4-(4-phenylbutoxy)benzoyl]amino]chromene-2-carboxylate |
|---|---|
| PubChem CID | 139926708 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | tert-butyl 4-oxo-8-[[4-(4-phenylbutoxy)benzoyl]amino]chromene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(=O)c2cccc(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)c2o1 |
| InChI | InChI=1S/C31H31NO6/c1-31(2,3)38-30(35)27-20-26(33)24-13-9-14-25(28(24)37-27)32-29(34)22-15-17-23(18-16-22)36-19-8-7-12-21-10-5-4-6-11-21/h4-6,9-11,13-18,20H,7-8,12,19H2,1-3H3,(H,32,34) |
| InChIKey | KVHRXCZNOZSVRK-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|