C35H41NO7 — CID 139926393
ditert-butyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate (PubChem CID 139926393) has the molecular formula C35H41NO7 and a molecular weight of 587.71 g/mol. Its IUPAC name is ditert-butyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate.
| Compound Name | ditert-butyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926393 |
| Molecular Formula | C35H41NO7 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | ditert-butyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate |
| SMILES | CC(C)(C)OC(=O)/C=C(/Oc1ccccc1NC(=O)c1ccc(OCCCCc2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H41NO7/c1-34(2,3)42-31(37)24-30(33(39)43-35(4,5)6)41-29-18-11-10-17-28(29)36-32(38)26-19-21-27(22-20-26)40-23-13-12-16-25-14-8-7-9-15-25/h7-11,14-15,17-22,24H,12-13,16,23H2,1-6H3,(H,36,38)/b30-24+ |
| InChIKey | XOLRKJOHMFEEEW-BGABXYSRSA-N |
| XLogP | 7.29 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|