C30H39NO6 — CID 139926420
ditert-butyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926420) has the molecular formula C30H39NO6 and a molecular weight of 509.64 g/mol. Its IUPAC name is ditert-butyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | ditert-butyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926420 |
| Molecular Formula | C30H39NO6 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | ditert-butyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccccc2O/C(=C/C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C30H39NO6/c1-8-9-10-13-21-16-18-22(19-17-21)27(33)31-23-14-11-12-15-24(23)35-25(28(34)37-30(5,6)7)20-26(32)36-29(2,3)4/h11-12,14-20H,8-10,13H2,1-7H3,(H,31,33)/b25-20+ |
| InChIKey | IIDBDIYQUJLOLD-LKUDQCMESA-N |
| XLogP | 6.62 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|