C29H37NO6 — CID 139926333
diethyl (E)-2-[2-[(4-octylbenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926333) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is diethyl (E)-2-[2-[(4-octylbenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | diethyl (E)-2-[2-[(4-octylbenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926333 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | diethyl (E)-2-[2-[(4-octylbenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCCCCc1ccc(C(=O)Nc2ccccc2O/C(=C/C(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C29H37NO6/c1-4-7-8-9-10-11-14-22-17-19-23(20-18-22)28(32)30-24-15-12-13-16-25(24)36-26(29(33)35-6-3)21-27(31)34-5-2/h12-13,15-21H,4-11,14H2,1-3H3,(H,30,32)/b26-21+ |
| InChIKey | KDOPLAWVNGSBFK-YYADALCUSA-N |
| XLogP | 6.23 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|