C23H25NO6 — CID 139926370
dipropyl (E)-2-(2-benzamidophenoxy)but-2-enedioate (PubChem CID 139926370) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is dipropyl (E)-2-(2-benzamidophenoxy)but-2-enedioate.
| Compound Name | dipropyl (E)-2-(2-benzamidophenoxy)but-2-enedioate |
|---|---|
| PubChem CID | 139926370 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | dipropyl (E)-2-(2-benzamidophenoxy)but-2-enedioate |
| SMILES | CCCOC(=O)/C=C(/Oc1ccccc1NC(=O)c1ccccc1)C(=O)OCCC |
| InChI | InChI=1S/C23H25NO6/c1-3-14-28-21(25)16-20(23(27)29-15-4-2)30-19-13-9-8-12-18(19)24-22(26)17-10-6-5-7-11-17/h5-13,16H,3-4,14-15H2,1-2H3,(H,24,26)/b20-16+ |
| InChIKey | CZGFQSCCTLXDQI-CAPFRKAQSA-N |
| XLogP | 4.11 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|