C38H55NO7 — CID 139926383
dihexyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926383) has the molecular formula C38H55NO7 and a molecular weight of 637.86 g/mol. Its IUPAC name is dihexyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | dihexyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926383 |
| Molecular Formula | C38H55NO7 |
| Molecular Weight | 637.86 g/mol |
| Exact Mass | 637.40 |
| IUPAC Name | dihexyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Nc2ccccc2O/C(=C\C(=O)OCCCCCC)C(=O)OCCCCCC)cc1 |
| InChI | InChI=1S/C38H55NO7/c1-4-7-10-13-14-15-20-27-43-32-25-23-31(24-26-32)37(41)39-33-21-16-17-22-34(33)46-35(38(42)45-29-19-12-9-6-3)30-36(40)44-28-18-11-8-5-2/h16-17,21-26,30H,4-15,18-20,27-29H2,1-3H3,(H,39,41)/b35-30- |
| InChIKey | FNRYOPVCOZCLAA-GXVXDJONSA-N |
| XLogP | 9.58 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.86 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|