C25H29NO7 — CID 139926325
diethyl (Z)-2-[2-[(4-butoxybenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926325) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is diethyl (Z)-2-[2-[(4-butoxybenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | diethyl (Z)-2-[2-[(4-butoxybenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926325 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | diethyl (Z)-2-[2-[(4-butoxybenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccccc2O/C(=C\C(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C25H29NO7/c1-4-7-16-32-19-14-12-18(13-15-19)24(28)26-20-10-8-9-11-21(20)33-22(25(29)31-6-3)17-23(27)30-5-2/h8-15,17H,4-7,16H2,1-3H3,(H,26,28)/b22-17- |
| InChIKey | JACZGDFCQJQLQL-XLNRJJMWSA-N |
| XLogP | 4.51 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|