C39H49NO7 — CID 139926498
dihexyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate (PubChem CID 139926498) has the molecular formula C39H49NO7 and a molecular weight of 643.82 g/mol. Its IUPAC name is dihexyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate.
| Compound Name | dihexyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926498 |
| Molecular Formula | C39H49NO7 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | dihexyl (E)-2-[2-[[4-(4-phenylbutoxy)benzoyl]amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCCOC(=O)/C=C(/Oc1ccccc1NC(=O)c1ccc(OCCCCc2ccccc2)cc1)C(=O)OCCCCCC |
| InChI | InChI=1S/C39H49NO7/c1-3-5-7-15-28-45-37(41)30-36(39(43)46-29-16-8-6-4-2)47-35-22-13-12-21-34(35)40-38(42)32-23-25-33(26-24-32)44-27-17-14-20-31-18-10-9-11-19-31/h9-13,18-19,21-26,30H,3-8,14-17,20,27-29H2,1-2H3,(H,40,42)/b36-30+ |
| InChIKey | QGCRVWRUDANZCW-FMIFUCRQSA-N |
| XLogP | 8.85 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|