C34H47NO7 — CID 139926367
dibutyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926367) has the molecular formula C34H47NO7 and a molecular weight of 581.75 g/mol. Its IUPAC name is dibutyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | dibutyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926367 |
| Molecular Formula | C34H47NO7 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | dibutyl (Z)-2-[2-[(4-nonoxybenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Nc2ccccc2O/C(=C\C(=O)OCCCC)C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C34H47NO7/c1-4-7-10-11-12-13-16-25-39-28-21-19-27(20-22-28)33(37)35-29-17-14-15-18-30(29)42-31(34(38)41-24-9-6-3)26-32(36)40-23-8-5-2/h14-15,17-22,26H,4-13,16,23-25H2,1-3H3,(H,35,37)/b31-26- |
| InChIKey | NPJIXDOCHHERTB-ZXPTYKNPSA-N |
| XLogP | 8.02 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|