C27H33NO7 — CID 139926511
diethyl (Z)-2-[2-[(4-hexoxybenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926511) has the molecular formula C27H33NO7 and a molecular weight of 483.56 g/mol. Its IUPAC name is diethyl (Z)-2-[2-[(4-hexoxybenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | diethyl (Z)-2-[2-[(4-hexoxybenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926511 |
| Molecular Formula | C27H33NO7 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | diethyl (Z)-2-[2-[(4-hexoxybenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccccc2O/C(=C\C(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C27H33NO7/c1-4-7-8-11-18-34-21-16-14-20(15-17-21)26(30)28-22-12-9-10-13-23(22)35-24(27(31)33-6-3)19-25(29)32-5-2/h9-10,12-17,19H,4-8,11,18H2,1-3H3,(H,28,30)/b24-19- |
| InChIKey | BXHCRFUSCCNQFY-CLCOLTQESA-N |
| XLogP | 5.29 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|