C32H43NO6 — CID 139926481
dibutyl (E)-2-[2-[(4-heptylbenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926481) has the molecular formula C32H43NO6 and a molecular weight of 537.70 g/mol. Its IUPAC name is dibutyl (E)-2-[2-[(4-heptylbenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | dibutyl (E)-2-[2-[(4-heptylbenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926481 |
| Molecular Formula | C32H43NO6 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | dibutyl (E)-2-[2-[(4-heptylbenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCCCc1ccc(C(=O)Nc2ccccc2O/C(=C/C(=O)OCCCC)C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C32H43NO6/c1-4-7-10-11-12-15-25-18-20-26(21-19-25)31(35)33-27-16-13-14-17-28(27)39-29(32(36)38-23-9-6-3)24-30(34)37-22-8-5-2/h13-14,16-21,24H,4-12,15,22-23H2,1-3H3,(H,33,35)/b29-24+ |
| InChIKey | ZEQJTOMLXYCKPY-RMLRFSFXSA-N |
| XLogP | 7.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|