C26H31NO6 — CID 139926448
diethyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate (PubChem CID 139926448) has the molecular formula C26H31NO6 and a molecular weight of 453.54 g/mol. Its IUPAC name is diethyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate.
| Compound Name | diethyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate |
|---|---|
| PubChem CID | 139926448 |
| Molecular Formula | C26H31NO6 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | diethyl (E)-2-[2-[(4-pentylbenzoyl)amino]phenoxy]but-2-enedioate |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccccc2O/C(=C/C(=O)OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C26H31NO6/c1-4-7-8-11-19-14-16-20(17-15-19)25(29)27-21-12-9-10-13-22(21)33-23(26(30)32-6-3)18-24(28)31-5-2/h9-10,12-18H,4-8,11H2,1-3H3,(H,27,29)/b23-18+ |
| InChIKey | HXLGEVJQTNOFGU-PTGBLXJZSA-N |
| XLogP | 5.06 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|