C25H29NO6 — CID 139926427
dibutyl (Z)-2-(2-benzamidophenoxy)but-2-enedioate (PubChem CID 139926427) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is dibutyl (Z)-2-(2-benzamidophenoxy)but-2-enedioate.
| Compound Name | dibutyl (Z)-2-(2-benzamidophenoxy)but-2-enedioate |
|---|---|
| PubChem CID | 139926427 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | dibutyl (Z)-2-(2-benzamidophenoxy)but-2-enedioate |
| SMILES | CCCCOC(=O)/C=C(\Oc1ccccc1NC(=O)c1ccccc1)C(=O)OCCCC |
| InChI | InChI=1S/C25H29NO6/c1-3-5-16-30-23(27)18-22(25(29)31-17-6-4-2)32-21-15-11-10-14-20(21)26-24(28)19-12-8-7-9-13-19/h7-15,18H,3-6,16-17H2,1-2H3,(H,26,28)/b22-18- |
| InChIKey | HVIKDMLQJMUANC-PYCFMQQDSA-N |
| XLogP | 4.89 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|