C26H30N2O6 — CID 139926830
N-hydroxy-8-[(4-nonoxybenzoyl)amino]-4-oxochromene-2-carboxamide (PubChem CID 139926830) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is N-hydroxy-8-[(4-nonoxybenzoyl)amino]-4-oxochromene-2-carboxamide.
| Compound Name | N-hydroxy-8-[(4-nonoxybenzoyl)amino]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 139926830 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-hydroxy-8-[(4-nonoxybenzoyl)amino]-4-oxochromene-2-carboxamide |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Nc2cccc3c(=O)cc(C(=O)NO)oc23)cc1 |
| InChI | InChI=1S/C26H30N2O6/c1-2-3-4-5-6-7-8-16-33-19-14-12-18(13-15-19)25(30)27-21-11-9-10-20-22(29)17-23(26(31)28-32)34-24(20)21/h9-15,17,32H,2-8,16H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | OCAIDDPOONTNMU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|